C27H44O7 — CID 70688906
[(2R,3S,4R,5R)-2-[[(1S,4S,4aR,6S,8aS)-6-[(2E,4E)-6-hydroxy-6-methylhepta-2,4-dien-2-yl]-4,4a-dimethyl-2,3,4,5,6,7,8,8a-octahydro-1H-naphthalen-1-yl]oxy]-4,5-dihydroxyoxan-3-yl] acetate (PubChem CID 70688906) has the molecular formula C27H44O7 and a molecular weight of 480.64 g/mol. Its IUPAC name is [(2R,3S,4R,5R)-2-[[(1S,4S,4aR,6S,8aS)-6-[(2E,4E)-6-hydroxy-6-methylhepta-2,4-dien-2-yl]-4,4a-dimethyl-2,3,4,5,6,7,8,8a-octahydro-1H-naphthalen-1-yl]oxy]-4,5-dihydroxyoxan-3-yl] acetate.
| Compound Name | [(2R,3S,4R,5R)-2-[[(1S,4S,4aR,6S,8aS)-6-[(2E,4E)-6-hydroxy-6-methylhepta-2,4-dien-2-yl]-4,4a-dimethyl-2,3,4,5,6,7,8,8a-octahydro-1H-naphthalen-1-yl]oxy]-4,5-dihydroxyoxan-3-yl] acetate |
|---|---|
| PubChem CID | 70688906 |
| Molecular Formula | C27H44O7 |
| Molecular Weight | 480.64 g/mol |
| Exact Mass | 480.31 |
| IUPAC Name | [(2R,3S,4R,5R)-2-[[(1S,4S,4aR,6S,8aS)-6-[(2E,4E)-6-hydroxy-6-methylhepta-2,4-dien-2-yl]-4,4a-dimethyl-2,3,4,5,6,7,8,8a-octahydro-1H-naphthalen-1-yl]oxy]-4,5-dihydroxyoxan-3-yl] acetate |
| SMILES | CC(=O)O[C@@H]1[C@@H](O[C@H]2CC[C@H](C)[C@@]3(C)C[C@@H](/C(C)=C/C=C/C(C)(C)O)CC[C@H]23)OC[C@@H](O)[C@H]1O |
| InChI | InChI=1S/C27H44O7/c1-16(8-7-13-26(4,5)31)19-10-11-20-22(12-9-17(2)27(20,6)14-19)34-25-24(33-18(3)28)23(30)21(29)15-32-25/h7-8,13,17,19-25,29-31H,9-12,14-15H2,1-6H3/b13-7+,16-8+/t17-,19-,20+,21+,22-,23+,24-,25+,27+/m0/s1 |
| InChIKey | MRYOFKDORPTZIE-BIEVFPKMSA-N |
| XLogP | 3.51 |
| TPSA | 105.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.64 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|