C15H7ClN2O2 — CID 141389603
6-chloropyrido[3,2-a]phenoxazin-5-one (PubChem CID 141389603) has the molecular formula C15H7ClN2O2 and a molecular weight of 282.69 g/mol. Its IUPAC name is 6-chloropyrido[3,2-a]phenoxazin-5-one.
| Compound Name | 6-chloropyrido[3,2-a]phenoxazin-5-one |
|---|---|
| PubChem CID | 141389603 |
| Molecular Formula | C15H7ClN2O2 |
| Molecular Weight | 282.69 g/mol |
| Exact Mass | 282.02 |
| IUPAC Name | 6-chloropyrido[3,2-a]phenoxazin-5-one |
| SMILES | O=c1c(Cl)c2oc3ccccc3nc-2c2cccnc12 |
| InChI | InChI=1S/C15H7ClN2O2/c16-11-14(19)12-8(4-3-7-17-12)13-15(11)20-10-6-2-1-5-9(10)18-13/h1-7H |
| InChIKey | YBZJYSUZKKYTMB-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 55.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.69 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|