C12H4Cl3NO2 — CID 56606166
1,2,4-trichlorophenoxazin-3-one (PubChem CID 56606166) has the molecular formula C12H4Cl3NO2 and a molecular weight of 300.53 g/mol. Its IUPAC name is 1,2,4-trichlorophenoxazin-3-one.
| Compound Name | 1,2,4-trichlorophenoxazin-3-one |
|---|---|
| PubChem CID | 56606166 |
| Molecular Formula | C12H4Cl3NO2 |
| Molecular Weight | 300.53 g/mol |
| Exact Mass | 298.93 |
| IUPAC Name | 1,2,4-trichlorophenoxazin-3-one |
| SMILES | O=c1c(Cl)c2oc3ccccc3nc-2c(Cl)c1Cl |
| InChI | InChI=1S/C12H4Cl3NO2/c13-7-8(14)11(17)9(15)12-10(7)16-5-3-1-2-4-6(5)18-12/h1-4H |
| InChIKey | WCQBLKRHAKMGTD-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 43.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.53 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|