C20H21BrN6O2 — CID 141391981
1-[4-(8-bromo-2-morpholin-4-ylpyrido[4,3-d]pyrimidin-4-yl)phenyl]-3-ethylurea (PubChem CID 141391981) has the molecular formula C20H21BrN6O2 and a molecular weight of 457.33 g/mol. Its IUPAC name is 1-[4-(8-bromo-2-morpholin-4-ylpyrido[4,3-d]pyrimidin-4-yl)phenyl]-3-ethylurea.
| Compound Name | 1-[4-(8-bromo-2-morpholin-4-ylpyrido[4,3-d]pyrimidin-4-yl)phenyl]-3-ethylurea |
|---|---|
| PubChem CID | 141391981 |
| Molecular Formula | C20H21BrN6O2 |
| Molecular Weight | 457.33 g/mol |
| Exact Mass | 456.09 |
| IUPAC Name | 1-[4-(8-bromo-2-morpholin-4-ylpyrido[4,3-d]pyrimidin-4-yl)phenyl]-3-ethylurea |
| SMILES | CCNC(=O)Nc1ccc(-c2nc(N3CCOCC3)nc3c(Br)cncc23)cc1 |
| InChI | InChI=1S/C20H21BrN6O2/c1-2-23-20(28)24-14-5-3-13(4-6-14)17-15-11-22-12-16(21)18(15)26-19(25-17)27-7-9-29-10-8-27/h3-6,11-12H,2,7-10H2,1H3,(H2,23,24,28) |
| InChIKey | YXXWZKDMWZNGLV-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 92.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.33 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |