C18H19ClN6O — CID 141395577
1-[(3R)-3-[6-amino-7-(4-chlorophenyl)-8H-purin-9-yl]pyrrolidin-1-yl]prop-2-en-1-one (PubChem CID 141395577) has the molecular formula C18H19ClN6O and a molecular weight of 370.84 g/mol. Its IUPAC name is 1-[(3R)-3-[6-amino-7-(4-chlorophenyl)-8H-purin-9-yl]pyrrolidin-1-yl]prop-2-en-1-one.
| Compound Name | 1-[(3R)-3-[6-amino-7-(4-chlorophenyl)-8H-purin-9-yl]pyrrolidin-1-yl]prop-2-en-1-one |
|---|---|
| PubChem CID | 141395577 |
| Molecular Formula | C18H19ClN6O |
| Molecular Weight | 370.84 g/mol |
| Exact Mass | 370.13 |
| IUPAC Name | 1-[(3R)-3-[6-amino-7-(4-chlorophenyl)-8H-purin-9-yl]pyrrolidin-1-yl]prop-2-en-1-one |
| SMILES | C=CC(=O)N1CC[C@@H](N2CN(c3ccc(Cl)cc3)c3c(N)ncnc32)C1 |
| InChI | InChI=1S/C18H19ClN6O/c1-2-15(26)23-8-7-14(9-23)25-11-24(13-5-3-12(19)4-6-13)16-17(20)21-10-22-18(16)25/h2-6,10,14H,1,7-9,11H2,(H2,20,21,22)/t14-/m1/s1 |
| InChIKey | YTNKTWOOBNFDRZ-CQSZACIVSA-N |
| XLogP | 2.41 |
| TPSA | 78.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.84 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|