C23H28Cl2N6O — CID 163626071
(E)-1-[(3R)-3-[4-amino-6-chloro-5-(4-chlorophenyl)-5-methyl-6H-pyrrolo[2,3-d]pyrimidin-7-yl]pyrrolidin-1-yl]-4-(dimethylamino)but-2-en-1-one (PubChem CID 163626071) has the molecular formula C23H28Cl2N6O and a molecular weight of 475.42 g/mol. Its IUPAC name is (E)-1-[(3R)-3-[4-amino-6-chloro-5-(4-chlorophenyl)-5-methyl-6H-pyrrolo[2,3-d]pyrimidin-7-yl]pyrrolidin-1-yl]-4-(dimethylamino)but-2-en-1-one.
| Compound Name | (E)-1-[(3R)-3-[4-amino-6-chloro-5-(4-chlorophenyl)-5-methyl-6H-pyrrolo[2,3-d]pyrimidin-7-yl]pyrrolidin-1-yl]-4-(dimethylamino)but-2-en-1-one |
|---|---|
| PubChem CID | 163626071 |
| Molecular Formula | C23H28Cl2N6O |
| Molecular Weight | 475.42 g/mol |
| Exact Mass | 474.17 |
| IUPAC Name | (E)-1-[(3R)-3-[4-amino-6-chloro-5-(4-chlorophenyl)-5-methyl-6H-pyrrolo[2,3-d]pyrimidin-7-yl]pyrrolidin-1-yl]-4-(dimethylamino)but-2-en-1-one |
| SMILES | CN(C)C/C=C/C(=O)N1CC[C@@H](N2c3ncnc(N)c3C(C)(c3ccc(Cl)cc3)C2Cl)C1 |
| InChI | InChI=1S/C23H28Cl2N6O/c1-23(15-6-8-16(24)9-7-15)19-20(26)27-14-28-21(19)31(22(23)25)17-10-12-30(13-17)18(32)5-4-11-29(2)3/h4-9,14,17,22H,10-13H2,1-3H3,(H2,26,27,28)/b5-4+/t17-,22?,23?/m1/s1 |
| InChIKey | HSCNWMSCWVOEIZ-QKMAGKBWSA-N |
| XLogP | 3.12 |
| TPSA | 78.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.42 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|