C8H18N2O4S — CID 141396718
dimethyl-[2-(prop-2-enoylamino)ethyl]azanium;methanesulfonate (PubChem CID 141396718) has the molecular formula C8H18N2O4S and a molecular weight of 238.31 g/mol. Its IUPAC name is dimethyl-[2-(prop-2-enoylamino)ethyl]azanium;methanesulfonate.
| Compound Name | dimethyl-[2-(prop-2-enoylamino)ethyl]azanium;methanesulfonate |
|---|---|
| PubChem CID | 141396718 |
| Molecular Formula | C8H18N2O4S |
| Molecular Weight | 238.31 g/mol |
| Exact Mass | 238.10 |
| IUPAC Name | dimethyl-[2-(prop-2-enoylamino)ethyl]azanium;methanesulfonate |
| SMILES | C=CC(=O)NCC[NH+](C)C.CS(=O)(=O)[O-] |
| InChI | InChI=1S/C7H14N2O.CH4O3S/c1-4-7(10)8-5-6-9(2)3;1-5(2,3)4/h4H,1,5-6H2,2-3H3,(H,8,10);1H3,(H,2,3,4) |
| InChIKey | QUGMOOFBNHXLBA-UHFFFAOYSA-N |
| XLogP | -2.41 |
| TPSA | 90.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.31 |
| LogP ≤ 5 | -2.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|