C18H20Cl2FN3O3 — CID 141397432
N-[[7-(4-chloro-3-fluorophenyl)-1,4-oxazepan-6-yl]oxy]-N-methylpyridine-3-carboxamide;hydrochloride (PubChem CID 141397432) has the molecular formula C18H20Cl2FN3O3 and a molecular weight of 416.28 g/mol. Its IUPAC name is N-[[7-(4-chloro-3-fluorophenyl)-1,4-oxazepan-6-yl]oxy]-N-methylpyridine-3-carboxamide;hydrochloride.
| Compound Name | N-[[7-(4-chloro-3-fluorophenyl)-1,4-oxazepan-6-yl]oxy]-N-methylpyridine-3-carboxamide;hydrochloride |
|---|---|
| PubChem CID | 141397432 |
| Molecular Formula | C18H20Cl2FN3O3 |
| Molecular Weight | 416.28 g/mol |
| Exact Mass | 415.09 |
| IUPAC Name | N-[[7-(4-chloro-3-fluorophenyl)-1,4-oxazepan-6-yl]oxy]-N-methylpyridine-3-carboxamide;hydrochloride |
| SMILES | CN(OC1CNCCOC1c1ccc(Cl)c(F)c1)C(=O)c1cccnc1.Cl |
| InChI | InChI=1S/C18H19ClFN3O3.ClH/c1-23(18(24)13-3-2-6-21-10-13)26-16-11-22-7-8-25-17(16)12-4-5-14(19)15(20)9-12;/h2-6,9-10,16-17,22H,7-8,11H2,1H3;1H |
| InChIKey | VCFFCPDJVIKRLR-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 63.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.28 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|