C18H19ClFN3O3 — CID 141397286
N-[[(6R,7S)-7-(4-chloro-3-fluorophenyl)-1,4-oxazepan-6-yl]oxy]-N-methylpyridine-3-carboxamide (PubChem CID 141397286) has the molecular formula C18H19ClFN3O3 and a molecular weight of 379.82 g/mol. Its IUPAC name is N-[[(6R,7S)-7-(4-chloro-3-fluorophenyl)-1,4-oxazepan-6-yl]oxy]-N-methylpyridine-3-carboxamide.
| Compound Name | N-[[(6R,7S)-7-(4-chloro-3-fluorophenyl)-1,4-oxazepan-6-yl]oxy]-N-methylpyridine-3-carboxamide |
|---|---|
| PubChem CID | 141397286 |
| Molecular Formula | C18H19ClFN3O3 |
| Molecular Weight | 379.82 g/mol |
| Exact Mass | 379.11 |
| IUPAC Name | N-[[(6R,7S)-7-(4-chloro-3-fluorophenyl)-1,4-oxazepan-6-yl]oxy]-N-methylpyridine-3-carboxamide |
| SMILES | CN(O[C@@H]1CNCCO[C@H]1c1ccc(Cl)c(F)c1)C(=O)c1cccnc1 |
| InChI | InChI=1S/C18H19ClFN3O3/c1-23(18(24)13-3-2-6-21-10-13)26-16-11-22-7-8-25-17(16)12-4-5-14(19)15(20)9-12/h2-6,9-10,16-17,22H,7-8,11H2,1H3/t16-,17+/m1/s1 |
| InChIKey | CAPCEYOMXAWCFV-SJORKVTESA-N |
| XLogP | 2.61 |
| TPSA | 63.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.82 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|