C7H21N5 — CID 141397796
2-[ethyl(methylamino)amino]-N,N-bis(methylamino)ethanamine (PubChem CID 141397796) has the molecular formula C7H21N5 and a molecular weight of 175.28 g/mol. Its IUPAC name is 2-[ethyl(methylamino)amino]-N,N-bis(methylamino)ethanamine.
| Compound Name | 2-[ethyl(methylamino)amino]-N,N-bis(methylamino)ethanamine |
|---|---|
| PubChem CID | 141397796 |
| Molecular Formula | C7H21N5 |
| Molecular Weight | 175.28 g/mol |
| Exact Mass | 175.18 |
| IUPAC Name | 2-[ethyl(methylamino)amino]-N,N-bis(methylamino)ethanamine |
| SMILES | CCN(CCN(NC)NC)NC |
| InChI | InChI=1S/C7H21N5/c1-5-11(8-2)6-7-12(9-3)10-4/h8-10H,5-7H2,1-4H3 |
| InChIKey | FTVJNLKLKZDUJF-UHFFFAOYSA-N |
| XLogP | -0.99 |
| TPSA | 42.57 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 175.28 |
| LogP ≤ 5 | -0.99 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|