C9H8BrClFNO3S — CID 141398458
3-(bromomethyl)-5-chloro-2-fluoro-N-methylsulfonylbenzamide (PubChem CID 141398458) has the molecular formula C9H8BrClFNO3S and a molecular weight of 344.59 g/mol. Its IUPAC name is 3-(bromomethyl)-5-chloro-2-fluoro-N-methylsulfonylbenzamide.
| Compound Name | 3-(bromomethyl)-5-chloro-2-fluoro-N-methylsulfonylbenzamide |
|---|---|
| PubChem CID | 141398458 |
| Molecular Formula | C9H8BrClFNO3S |
| Molecular Weight | 344.59 g/mol |
| Exact Mass | 342.91 |
| IUPAC Name | 3-(bromomethyl)-5-chloro-2-fluoro-N-methylsulfonylbenzamide |
| SMILES | CS(=O)(=O)NC(=O)c1cc(Cl)cc(CBr)c1F |
| InChI | InChI=1S/C9H8BrClFNO3S/c1-17(15,16)13-9(14)7-3-6(11)2-5(4-10)8(7)12/h2-3H,4H2,1H3,(H,13,14) |
| InChIKey | JUZKAUNCNYTJMK-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 63.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.59 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|