C18H22F4O — CID 141398493
1-cyclopropyl-4-fluoro-2-[[1-methyl-4-(trifluoromethyl)cyclohexyl]methoxy]benzene (PubChem CID 141398493) has the molecular formula C18H22F4O and a molecular weight of 330.37 g/mol. Its IUPAC name is 1-cyclopropyl-4-fluoro-2-[[1-methyl-4-(trifluoromethyl)cyclohexyl]methoxy]benzene.
| Compound Name | 1-cyclopropyl-4-fluoro-2-[[1-methyl-4-(trifluoromethyl)cyclohexyl]methoxy]benzene |
|---|---|
| PubChem CID | 141398493 |
| Molecular Formula | C18H22F4O |
| Molecular Weight | 330.37 g/mol |
| Exact Mass | 330.16 |
| IUPAC Name | 1-cyclopropyl-4-fluoro-2-[[1-methyl-4-(trifluoromethyl)cyclohexyl]methoxy]benzene |
| SMILES | CC1(COc2cc(F)ccc2C2CC2)CCC(C(F)(F)F)CC1 |
| InChI | InChI=1S/C18H22F4O/c1-17(8-6-13(7-9-17)18(20,21)22)11-23-16-10-14(19)4-5-15(16)12-2-3-12/h4-5,10,12-13H,2-3,6-9,11H2,1H3 |
| InChIKey | LVARDOARSSQTNI-UHFFFAOYSA-N |
| XLogP | 5.84 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.37 |
| LogP ≤ 5 | 5.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |