C8H7NOS — CID 141403172
3-methyl-2,1-benzothiazole 2-oxide (PubChem CID 141403172) has the molecular formula C8H7NOS and a molecular weight of 165.22 g/mol. Its IUPAC name is 3-methyl-2,1-benzothiazole 2-oxide.
| Compound Name | 3-methyl-2,1-benzothiazole 2-oxide |
|---|---|
| PubChem CID | 141403172 |
| Molecular Formula | C8H7NOS |
| Molecular Weight | 165.22 g/mol |
| Exact Mass | 165.02 |
| IUPAC Name | 3-methyl-2,1-benzothiazole 2-oxide |
| SMILES | CC1=c2ccccc2=NS1=O |
| InChI | InChI=1S/C8H7NOS/c1-6-7-4-2-3-5-8(7)9-11(6)10/h2-5H,1H3 |
| InChIKey | RHQRUEQMNGHXMF-UHFFFAOYSA-N |
| XLogP | 0.11 |
| TPSA | 29.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 165.22 |
| LogP ≤ 5 | 0.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |