C10H13NO2S — CID 142275683
3,4-dimethyl-5-[(1Z,3Z)-penta-1,3-dienyl]-1,2-thiazole 1,1-dioxide (PubChem CID 142275683) has the molecular formula C10H13NO2S and a molecular weight of 211.29 g/mol. Its IUPAC name is 3,4-dimethyl-5-[(1Z,3Z)-penta-1,3-dienyl]-1,2-thiazole 1,1-dioxide.
| Compound Name | 3,4-dimethyl-5-[(1Z,3Z)-penta-1,3-dienyl]-1,2-thiazole 1,1-dioxide |
|---|---|
| PubChem CID | 142275683 |
| Molecular Formula | C10H13NO2S |
| Molecular Weight | 211.29 g/mol |
| Exact Mass | 211.07 |
| IUPAC Name | 3,4-dimethyl-5-[(1Z,3Z)-penta-1,3-dienyl]-1,2-thiazole 1,1-dioxide |
| SMILES | C/C=C\C=C/C1=C(C)C(C)=NS1(=O)=O |
| InChI | InChI=1S/C10H13NO2S/c1-4-5-6-7-10-8(2)9(3)11-14(10,12)13/h4-7H,1-3H3/b5-4-,7-6- |
| InChIKey | MOUOHLNHQSKZAJ-RZSVFLSASA-N |
| XLogP | 2.20 |
| TPSA | 46.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.29 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|