C11H13NO2S — CID 177482483
(NZ)-N-(6-methylidenecyclohexa-2,4-dien-1-ylidene)but-3-ene-1-sulfonamide (PubChem CID 177482483) has the molecular formula C11H13NO2S and a molecular weight of 223.30 g/mol. Its IUPAC name is (NZ)-N-(6-methylidenecyclohexa-2,4-dien-1-ylidene)but-3-ene-1-sulfonamide.
| Compound Name | (NZ)-N-(6-methylidenecyclohexa-2,4-dien-1-ylidene)but-3-ene-1-sulfonamide |
|---|---|
| PubChem CID | 177482483 |
| Molecular Formula | C11H13NO2S |
| Molecular Weight | 223.30 g/mol |
| Exact Mass | 223.07 |
| IUPAC Name | (NZ)-N-(6-methylidenecyclohexa-2,4-dien-1-ylidene)but-3-ene-1-sulfonamide |
| SMILES | C=CCCS(=O)(=O)/N=C1/C=CC=CC1=C |
| InChI | InChI=1S/C11H13NO2S/c1-3-4-9-15(13,14)12-11-8-6-5-7-10(11)2/h3,5-8H,1-2,4,9H2/b12-11- |
| InChIKey | NCHSCNLLYIZAPE-QXMHVHEDSA-N |
| XLogP | 2.02 |
| TPSA | 46.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.30 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|