C11H13NS — CID 143457828
ethane;9-methyl-7-thia-8-azabicyclo[4.3.1]deca-1(10),2,4,6(10),8-pentaene (PubChem CID 143457828) has the molecular formula C11H13NS and a molecular weight of 191.30 g/mol. Its IUPAC name is ethane;9-methyl-7-thia-8-azabicyclo[4.3.1]deca-1(10),2,4,6(10),8-pentaene.
| Compound Name | ethane;9-methyl-7-thia-8-azabicyclo[4.3.1]deca-1(10),2,4,6(10),8-pentaene |
|---|---|
| PubChem CID | 143457828 |
| Molecular Formula | C11H13NS |
| Molecular Weight | 191.30 g/mol |
| Exact Mass | 191.08 |
| IUPAC Name | ethane;9-methyl-7-thia-8-azabicyclo[4.3.1]deca-1(10),2,4,6(10),8-pentaene |
| SMILES | CC.CC1=NSC2=C=C1C=CC=C2 |
| InChI | InChI=1S/C9H7NS.C2H6/c1-7-8-4-2-3-5-9(6-8)11-10-7;1-2/h2-5H,1H3;1-2H3 |
| InChIKey | FYLCPBSAAQVYIW-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 191.30 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|