C13H18O3 — CID 141403387
(7-hydroxy-8-tricyclo[5.2.1.02,6]decanyl) prop-2-enoate (PubChem CID 141403387) has the molecular formula C13H18O3 and a molecular weight of 222.28 g/mol. Its IUPAC name is (7-hydroxy-8-tricyclo[5.2.1.02,6]decanyl) prop-2-enoate.
| Compound Name | (7-hydroxy-8-tricyclo[5.2.1.02,6]decanyl) prop-2-enoate |
|---|---|
| PubChem CID | 141403387 |
| Molecular Formula | C13H18O3 |
| Molecular Weight | 222.28 g/mol |
| Exact Mass | 222.13 |
| IUPAC Name | (7-hydroxy-8-tricyclo[5.2.1.02,6]decanyl) prop-2-enoate |
| SMILES | C=CC(=O)OC1CC2CC1(O)C1CCCC21 |
| InChI | InChI=1S/C13H18O3/c1-2-12(14)16-11-6-8-7-13(11,15)10-5-3-4-9(8)10/h2,8-11,15H,1,3-7H2 |
| InChIKey | ODBHAWBPONKEIK-UHFFFAOYSA-N |
| XLogP | 1.66 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.28 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|