C13H18O4 — CID 22889408
(4,5-dihydroxy-8-tricyclo[5.2.1.02,6]decanyl) prop-2-enoate (PubChem CID 22889408) has the molecular formula C13H18O4 and a molecular weight of 238.28 g/mol. Its IUPAC name is (4,5-dihydroxy-8-tricyclo[5.2.1.02,6]decanyl) prop-2-enoate.
| Compound Name | (4,5-dihydroxy-8-tricyclo[5.2.1.02,6]decanyl) prop-2-enoate |
|---|---|
| PubChem CID | 22889408 |
| Molecular Formula | C13H18O4 |
| Molecular Weight | 238.28 g/mol |
| Exact Mass | 238.12 |
| IUPAC Name | (4,5-dihydroxy-8-tricyclo[5.2.1.02,6]decanyl) prop-2-enoate |
| SMILES | C=CC(=O)OC1CC2CC1C1C(O)C(O)CC21 |
| InChI | InChI=1S/C13H18O4/c1-2-11(15)17-10-4-6-3-8(10)12-7(6)5-9(14)13(12)16/h2,6-10,12-14,16H,1,3-5H2 |
| InChIKey | VXUDXVVTYIPLID-UHFFFAOYSA-N |
| XLogP | 0.48 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.28 |
| LogP ≤ 5 | 0.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|