C22H24F6OSi2 — CID 141405266
ethenyl-[ethenyl-phenyl-(3,3,3-trifluoropropyl)silyl]oxy-phenyl-(3,3,3-trifluoropropyl)silane (PubChem CID 141405266) has the molecular formula C22H24F6OSi2 and a molecular weight of 474.59 g/mol. Its IUPAC name is ethenyl-[ethenyl-phenyl-(3,3,3-trifluoropropyl)silyl]oxy-phenyl-(3,3,3-trifluoropropyl)silane.
| Compound Name | ethenyl-[ethenyl-phenyl-(3,3,3-trifluoropropyl)silyl]oxy-phenyl-(3,3,3-trifluoropropyl)silane |
|---|---|
| PubChem CID | 141405266 |
| Molecular Formula | C22H24F6OSi2 |
| Molecular Weight | 474.59 g/mol |
| Exact Mass | 474.13 |
| IUPAC Name | ethenyl-[ethenyl-phenyl-(3,3,3-trifluoropropyl)silyl]oxy-phenyl-(3,3,3-trifluoropropyl)silane |
| SMILES | C=C[Si](CCC(F)(F)F)(O[Si](C=C)(CCC(F)(F)F)c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C22H24F6OSi2/c1-3-30(17-15-21(23,24)25,19-11-7-5-8-12-19)29-31(4-2,18-16-22(26,27)28)20-13-9-6-10-14-20/h3-14H,1-2,15-18H2 |
| InChIKey | YJUIRSDHTFFSMM-UHFFFAOYSA-N |
| XLogP | 6.06 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.59 |
| LogP ≤ 5 | 6.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|