C11H12BrF2N3O3 — CID 141406577
2-[[6-bromo-4-[[(2S)-3,3-difluorobutan-2-yl]amino]-3-pyridinyl]amino]-2-oxoacetic acid (PubChem CID 141406577) has the molecular formula C11H12BrF2N3O3 and a molecular weight of 352.14 g/mol. Its IUPAC name is 2-[[6-bromo-4-[[(2S)-3,3-difluorobutan-2-yl]amino]-3-pyridinyl]amino]-2-oxoacetic acid.
| Compound Name | 2-[[6-bromo-4-[[(2S)-3,3-difluorobutan-2-yl]amino]-3-pyridinyl]amino]-2-oxoacetic acid |
|---|---|
| PubChem CID | 141406577 |
| Molecular Formula | C11H12BrF2N3O3 |
| Molecular Weight | 352.14 g/mol |
| Exact Mass | 351.00 |
| IUPAC Name | 2-[[6-bromo-4-[[(2S)-3,3-difluorobutan-2-yl]amino]-3-pyridinyl]amino]-2-oxoacetic acid |
| SMILES | C[C@H](Nc1cc(Br)ncc1NC(=O)C(=O)O)C(C)(F)F |
| InChI | InChI=1S/C11H12BrF2N3O3/c1-5(11(2,13)14)16-6-3-8(12)15-4-7(6)17-9(18)10(19)20/h3-5H,1-2H3,(H,15,16)(H,17,18)(H,19,20)/t5-/m0/s1 |
| InChIKey | WRISEHUYZANEQB-YFKPBYRVSA-N |
| XLogP | 2.32 |
| TPSA | 91.32 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.14 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|