C20H28FN3OS — CID 141406985
1-tert-butyl-5-(4-fluorophenyl)-N-(6-sulfanylhexyl)pyrazole-3-carboxamide (PubChem CID 141406985) has the molecular formula C20H28FN3OS and a molecular weight of 377.53 g/mol. Its IUPAC name is 1-tert-butyl-5-(4-fluorophenyl)-N-(6-sulfanylhexyl)pyrazole-3-carboxamide.
| Compound Name | 1-tert-butyl-5-(4-fluorophenyl)-N-(6-sulfanylhexyl)pyrazole-3-carboxamide |
|---|---|
| PubChem CID | 141406985 |
| Molecular Formula | C20H28FN3OS |
| Molecular Weight | 377.53 g/mol |
| Exact Mass | 377.19 |
| IUPAC Name | 1-tert-butyl-5-(4-fluorophenyl)-N-(6-sulfanylhexyl)pyrazole-3-carboxamide |
| SMILES | CC(C)(C)n1nc(C(=O)NCCCCCCS)cc1-c1ccc(F)cc1 |
| InChI | InChI=1S/C20H28FN3OS/c1-20(2,3)24-18(15-8-10-16(21)11-9-15)14-17(23-24)19(25)22-12-6-4-5-7-13-26/h8-11,14,26H,4-7,12-13H2,1-3H3,(H,22,25) |
| InChIKey | MBOKQDXKJZMUCF-UHFFFAOYSA-N |
| XLogP | 4.66 |
| TPSA | 46.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.53 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|