C27H34ClN5O — CID 51349331
N-[2-(4-benzylpiperazin-1-yl)ethyl]-1-tert-butyl-5-(4-chlorophenyl)pyrazole-3-carboxamide (PubChem CID 51349331) has the molecular formula C27H34ClN5O and a molecular weight of 480.06 g/mol. Its IUPAC name is N-[2-(4-benzylpiperazin-1-yl)ethyl]-1-tert-butyl-5-(4-chlorophenyl)pyrazole-3-carboxamide.
| Compound Name | N-[2-(4-benzylpiperazin-1-yl)ethyl]-1-tert-butyl-5-(4-chlorophenyl)pyrazole-3-carboxamide |
|---|---|
| PubChem CID | 51349331 |
| Molecular Formula | C27H34ClN5O |
| Molecular Weight | 480.06 g/mol |
| Exact Mass | 479.25 |
| IUPAC Name | N-[2-(4-benzylpiperazin-1-yl)ethyl]-1-tert-butyl-5-(4-chlorophenyl)pyrazole-3-carboxamide |
| SMILES | CC(C)(C)n1nc(C(=O)NCCN2CCN(Cc3ccccc3)CC2)cc1-c1ccc(Cl)cc1 |
| InChI | InChI=1S/C27H34ClN5O/c1-27(2,3)33-25(22-9-11-23(28)12-10-22)19-24(30-33)26(34)29-13-14-31-15-17-32(18-16-31)20-21-7-5-4-6-8-21/h4-12,19H,13-18,20H2,1-3H3,(H,29,34) |
| InChIKey | APEXRCGOWJPMNC-UHFFFAOYSA-N |
| XLogP | 4.51 |
| TPSA | 53.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.06 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |