C20H28FN3O2S — CID 127026739
3-(4-fluorophenyl)-1-(4-hydroxybutyl)-N-(6-sulfanylhexyl)pyrazole-5-carboxamide (PubChem CID 127026739) has the molecular formula C20H28FN3O2S and a molecular weight of 393.53 g/mol. Its IUPAC name is 3-(4-fluorophenyl)-1-(4-hydroxybutyl)-N-(6-sulfanylhexyl)pyrazole-5-carboxamide.
| Compound Name | 3-(4-fluorophenyl)-1-(4-hydroxybutyl)-N-(6-sulfanylhexyl)pyrazole-5-carboxamide |
|---|---|
| PubChem CID | 127026739 |
| Molecular Formula | C20H28FN3O2S |
| Molecular Weight | 393.53 g/mol |
| Exact Mass | 393.19 |
| IUPAC Name | 3-(4-fluorophenyl)-1-(4-hydroxybutyl)-N-(6-sulfanylhexyl)pyrazole-5-carboxamide |
| SMILES | O=C(NCCCCCCS)c1cc(-c2ccc(F)cc2)nn1CCCCO |
| InChI | InChI=1S/C20H28FN3O2S/c21-17-9-7-16(8-10-17)18-15-19(24(23-18)12-4-5-13-25)20(26)22-11-3-1-2-6-14-27/h7-10,15,25,27H,1-6,11-14H2,(H,22,26) |
| InChIKey | RQNKLRPNWLIDAS-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 67.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.53 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|