C15H18N2O6S — CID 141407070
[(3S)-1-but-2-enoylpiperidin-3-yl] 4-nitrobenzenesulfonate (PubChem CID 141407070) has the molecular formula C15H18N2O6S and a molecular weight of 354.38 g/mol. Its IUPAC name is [(3S)-1-but-2-enoylpiperidin-3-yl] 4-nitrobenzenesulfonate.
| Compound Name | [(3S)-1-but-2-enoylpiperidin-3-yl] 4-nitrobenzenesulfonate |
|---|---|
| PubChem CID | 141407070 |
| Molecular Formula | C15H18N2O6S |
| Molecular Weight | 354.38 g/mol |
| Exact Mass | 354.09 |
| IUPAC Name | [(3S)-1-but-2-enoylpiperidin-3-yl] 4-nitrobenzenesulfonate |
| SMILES | CC=CC(=O)N1CCC[C@H](OS(=O)(=O)c2ccc([N+](=O)[O-])cc2)C1 |
| InChI | InChI=1S/C15H18N2O6S/c1-2-4-15(18)16-10-3-5-13(11-16)23-24(21,22)14-8-6-12(7-9-14)17(19)20/h2,4,6-9,13H,3,5,10-11H2,1H3/t13-/m0/s1 |
| InChIKey | ZJJRMIYJEBNPEY-ZDUSSCGKSA-N |
| XLogP | 1.87 |
| TPSA | 106.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.38 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|