C46H42F2N2O — CID 141409660
3,5-bis[3-[3-(4-fluorophenyl)-1-propan-2-ylindol-2-yl]prop-2-enylidene]cyclohexan-1-one (PubChem CID 141409660) has the molecular formula C46H42F2N2O and a molecular weight of 676.85 g/mol. Its IUPAC name is 3,5-bis[3-[3-(4-fluorophenyl)-1-propan-2-ylindol-2-yl]prop-2-enylidene]cyclohexan-1-one.
| Compound Name | 3,5-bis[3-[3-(4-fluorophenyl)-1-propan-2-ylindol-2-yl]prop-2-enylidene]cyclohexan-1-one |
|---|---|
| PubChem CID | 141409660 |
| Molecular Formula | C46H42F2N2O |
| Molecular Weight | 676.85 g/mol |
| Exact Mass | 676.33 |
| IUPAC Name | 3,5-bis[3-[3-(4-fluorophenyl)-1-propan-2-ylindol-2-yl]prop-2-enylidene]cyclohexan-1-one |
| SMILES | CC(C)n1c(C=CC=C2CC(=O)CC(=CC=Cc3c(-c4ccc(F)cc4)c4ccccc4n3C(C)C)C2)c(-c2ccc(F)cc2)c2ccccc21 |
| InChI | InChI=1S/C46H42F2N2O/c1-30(2)49-41-15-7-5-13-39(41)45(34-19-23-36(47)24-20-34)43(49)17-9-11-32-27-33(29-38(51)28-32)12-10-18-44-46(35-21-25-37(48)26-22-35)40-14-6-8-16-42(40)50(44)31(3)4/h5-26,30-31H,27-29H2,1-4H3 |
| InChIKey | UBHGSNUSSPEHTP-UHFFFAOYSA-N |
| XLogP | 12.70 |
| TPSA | 26.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 676.85 |
| LogP ≤ 5 | 12.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |