C20H18ClF4N5O3 — CID 141409963
N-[4-chloro-3-(trifluoromethyl)phenyl]-5-fluoro-2-[2-(3,4,5-trimethoxyphenyl)hydrazinyl]pyrimidin-4-amine (PubChem CID 141409963) has the molecular formula C20H18ClF4N5O3 and a molecular weight of 487.84 g/mol. Its IUPAC name is N-[4-chloro-3-(trifluoromethyl)phenyl]-5-fluoro-2-[2-(3,4,5-trimethoxyphenyl)hydrazinyl]pyrimidin-4-amine.
| Compound Name | N-[4-chloro-3-(trifluoromethyl)phenyl]-5-fluoro-2-[2-(3,4,5-trimethoxyphenyl)hydrazinyl]pyrimidin-4-amine |
|---|---|
| PubChem CID | 141409963 |
| Molecular Formula | C20H18ClF4N5O3 |
| Molecular Weight | 487.84 g/mol |
| Exact Mass | 487.10 |
| IUPAC Name | N-[4-chloro-3-(trifluoromethyl)phenyl]-5-fluoro-2-[2-(3,4,5-trimethoxyphenyl)hydrazinyl]pyrimidin-4-amine |
| SMILES | COc1cc(NNc2ncc(F)c(Nc3ccc(Cl)c(C(F)(F)F)c3)n2)cc(OC)c1OC |
| InChI | InChI=1S/C20H18ClF4N5O3/c1-31-15-7-11(8-16(32-2)17(15)33-3)29-30-19-26-9-14(22)18(28-19)27-10-4-5-13(21)12(6-10)20(23,24)25/h4-9,29H,1-3H3,(H2,26,27,28,30) |
| InChIKey | FIOAQXJVMJADJY-UHFFFAOYSA-N |
| XLogP | 5.50 |
| TPSA | 89.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.84 |
| LogP ≤ 5 | 5.50 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|