C11H13N3O3S — CID 141410970
1-[(4-methoxyphenyl)methyl]-3-methylsulfonyl-1,2,4-triazole (PubChem CID 141410970) has the molecular formula C11H13N3O3S and a molecular weight of 267.31 g/mol. Its IUPAC name is 1-[(4-methoxyphenyl)methyl]-3-methylsulfonyl-1,2,4-triazole.
| Compound Name | 1-[(4-methoxyphenyl)methyl]-3-methylsulfonyl-1,2,4-triazole |
|---|---|
| PubChem CID | 141410970 |
| Molecular Formula | C11H13N3O3S |
| Molecular Weight | 267.31 g/mol |
| Exact Mass | 267.07 |
| IUPAC Name | 1-[(4-methoxyphenyl)methyl]-3-methylsulfonyl-1,2,4-triazole |
| SMILES | COc1ccc(Cn2cnc(S(C)(=O)=O)n2)cc1 |
| InChI | InChI=1S/C11H13N3O3S/c1-17-10-5-3-9(4-6-10)7-14-8-12-11(13-14)18(2,15)16/h3-6,8H,7H2,1-2H3 |
| InChIKey | RCNKEQFIEIUDNX-UHFFFAOYSA-N |
| XLogP | 0.74 |
| TPSA | 74.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.31 |
| LogP ≤ 5 | 0.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |