C15H14O10S2 — CID 141411359
4,6-dihydroxy-5-(2-phenylethoxycarbonyl)benzene-1,3-disulfonic acid (PubChem CID 141411359) has the molecular formula C15H14O10S2 and a molecular weight of 418.40 g/mol. Its IUPAC name is 4,6-dihydroxy-5-(2-phenylethoxycarbonyl)benzene-1,3-disulfonic acid.
| Compound Name | 4,6-dihydroxy-5-(2-phenylethoxycarbonyl)benzene-1,3-disulfonic acid |
|---|---|
| PubChem CID | 141411359 |
| Molecular Formula | C15H14O10S2 |
| Molecular Weight | 418.40 g/mol |
| Exact Mass | 418.00 |
| IUPAC Name | 4,6-dihydroxy-5-(2-phenylethoxycarbonyl)benzene-1,3-disulfonic acid |
| SMILES | O=C(OCCc1ccccc1)c1c(O)c(S(=O)(=O)O)cc(S(=O)(=O)O)c1O |
| InChI | InChI=1S/C15H14O10S2/c16-13-10(26(19,20)21)8-11(27(22,23)24)14(17)12(13)15(18)25-7-6-9-4-2-1-3-5-9/h1-5,8,16-17H,6-7H2,(H,19,20,21)(H,22,23,24) |
| InChIKey | YJYXEUVKIGGRFZ-UHFFFAOYSA-N |
| XLogP | 0.99 |
| TPSA | 175.50 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.40 |
| LogP ≤ 5 | 0.99 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|