C24H31N5O2S — CID 141414299
ethyl 2-[2-[4-(5-cyano-1H-indol-3-yl)butyl-methylamino]ethyl-methylamino]-4-methyl-1,3-thiazole-5-carboxylate (PubChem CID 141414299) has the molecular formula C24H31N5O2S and a molecular weight of 453.61 g/mol. Its IUPAC name is ethyl 2-[2-[4-(5-cyano-1H-indol-3-yl)butyl-methylamino]ethyl-methylamino]-4-methyl-1,3-thiazole-5-carboxylate.
| Compound Name | ethyl 2-[2-[4-(5-cyano-1H-indol-3-yl)butyl-methylamino]ethyl-methylamino]-4-methyl-1,3-thiazole-5-carboxylate |
|---|---|
| PubChem CID | 141414299 |
| Molecular Formula | C24H31N5O2S |
| Molecular Weight | 453.61 g/mol |
| Exact Mass | 453.22 |
| IUPAC Name | ethyl 2-[2-[4-(5-cyano-1H-indol-3-yl)butyl-methylamino]ethyl-methylamino]-4-methyl-1,3-thiazole-5-carboxylate |
| SMILES | CCOC(=O)c1sc(N(C)CCN(C)CCCCc2c[nH]c3ccc(C#N)cc23)nc1C |
| InChI | InChI=1S/C24H31N5O2S/c1-5-31-23(30)22-17(2)27-24(32-22)29(4)13-12-28(3)11-7-6-8-19-16-26-21-10-9-18(15-25)14-20(19)21/h9-10,14,16,26H,5-8,11-13H2,1-4H3 |
| InChIKey | DOUDVONJVUNMPY-UHFFFAOYSA-N |
| XLogP | 4.37 |
| TPSA | 85.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.61 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|