C22H19N3O2 — CID 57183288
5-[4-(5-cyano-1H-indol-3-yl)butyl]cyclopenta[b]pyran-6-carboxamide (PubChem CID 57183288) has the molecular formula C22H19N3O2 and a molecular weight of 357.41 g/mol. Its IUPAC name is 5-[4-(5-cyano-1H-indol-3-yl)butyl]cyclopenta[b]pyran-6-carboxamide.
| Compound Name | 5-[4-(5-cyano-1H-indol-3-yl)butyl]cyclopenta[b]pyran-6-carboxamide |
|---|---|
| PubChem CID | 57183288 |
| Molecular Formula | C22H19N3O2 |
| Molecular Weight | 357.41 g/mol |
| Exact Mass | 357.15 |
| IUPAC Name | 5-[4-(5-cyano-1H-indol-3-yl)butyl]cyclopenta[b]pyran-6-carboxamide |
| SMILES | N#Cc1ccc2[nH]cc(CCCCc3c(C(N)=O)cc4occcc3-4)c2c1 |
| InChI | InChI=1S/C22H19N3O2/c23-12-14-7-8-20-18(10-14)15(13-25-20)4-1-2-5-16-17-6-3-9-27-21(17)11-19(16)22(24)26/h3,6-11,13,25H,1-2,4-5H2,(H2,24,26) |
| InChIKey | YWNPGQLKOVARER-UHFFFAOYSA-N |
| XLogP | 4.40 |
| TPSA | 95.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.41 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|