C26H28BN3O2S — CID 141414822
[4-[9-(6-methylheptyl)carbazol-2-yl]-2,1,3-benzothiadiazol-7-yl]boronic acid (PubChem CID 141414822) has the molecular formula C26H28BN3O2S and a molecular weight of 457.41 g/mol. Its IUPAC name is [4-[9-(6-methylheptyl)carbazol-2-yl]-2,1,3-benzothiadiazol-7-yl]boronic acid.
| Compound Name | [4-[9-(6-methylheptyl)carbazol-2-yl]-2,1,3-benzothiadiazol-7-yl]boronic acid |
|---|---|
| PubChem CID | 141414822 |
| Molecular Formula | C26H28BN3O2S |
| Molecular Weight | 457.41 g/mol |
| Exact Mass | 457.20 |
| IUPAC Name | [4-[9-(6-methylheptyl)carbazol-2-yl]-2,1,3-benzothiadiazol-7-yl]boronic acid |
| SMILES | CC(C)CCCCCn1c2ccccc2c2ccc(-c3ccc(B(O)O)c4nsnc34)cc21 |
| InChI | InChI=1S/C26H28BN3O2S/c1-17(2)8-4-3-7-15-30-23-10-6-5-9-20(23)21-12-11-18(16-24(21)30)19-13-14-22(27(31)32)26-25(19)28-33-29-26/h5-6,9-14,16-17,31-32H,3-4,7-8,15H2,1-2H3 |
| InChIKey | WMLHROYWWIYCKH-UHFFFAOYSA-N |
| XLogP | 5.36 |
| TPSA | 71.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.41 |
| LogP ≤ 5 | 5.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|