C58H72B2N4O4S — CID 102221956
4,7-bis[9-octyl-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)carbazol-3-yl]-2,1,3-benzothiadiazole (PubChem CID 102221956) has the molecular formula C58H72B2N4O4S and a molecular weight of 942.93 g/mol. Its IUPAC name is 4,7-bis[9-octyl-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)carbazol-3-yl]-2,1,3-benzothiadiazole.
| Compound Name | 4,7-bis[9-octyl-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)carbazol-3-yl]-2,1,3-benzothiadiazole |
|---|---|
| PubChem CID | 102221956 |
| Molecular Formula | C58H72B2N4O4S |
| Molecular Weight | 942.93 g/mol |
| Exact Mass | 942.55 |
| IUPAC Name | 4,7-bis[9-octyl-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)carbazol-3-yl]-2,1,3-benzothiadiazole |
| SMILES | CCCCCCCCn1c2ccc(B3OC(C)(C)C(C)(C)O3)cc2c2cc(-c3ccc(-c4ccc5c(c4)c4cc(B6OC(C)(C)C(C)(C)O6)ccc4n5CCCCCCCC)c4nsnc34)ccc21 |
| InChI | InChI=1S/C58H72B2N4O4S/c1-11-13-15-17-19-21-33-63-49-29-23-39(35-45(49)47-37-41(25-31-51(47)63)59-65-55(3,4)56(5,6)66-59)43-27-28-44(54-53(43)61-69-62-54)40-24-30-50-46(36-40)48-38-42(60-67-57(7,8)58(9,10)68-60)26-32-52(48)64(50)34-22-20-18-16-14-12-2/h23-32,35-38H,11-22,33-34H2,1-10H3 |
| InChIKey | AHZXFWNWBZJMMB-UHFFFAOYSA-N |
| XLogP | 14.56 |
| TPSA | 72.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 69 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 942.93 |
| LogP ≤ 5 | 14.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|