C28H43B2NO4S2 — CID 155887929
7-octyl-4,10-bis(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-3,11-dithia-7-azatricyclo[6.3.0.02,6]undeca-1(8),2(6),4,9-tetraene (PubChem CID 155887929) has the molecular formula C28H43B2NO4S2 and a molecular weight of 543.41 g/mol. Its IUPAC name is 7-octyl-4,10-bis(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-3,11-dithia-7-azatricyclo[6.3.0.02,6]undeca-1(8),2(6),4,9-tetraene.
| Compound Name | 7-octyl-4,10-bis(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-3,11-dithia-7-azatricyclo[6.3.0.02,6]undeca-1(8),2(6),4,9-tetraene |
|---|---|
| PubChem CID | 155887929 |
| Molecular Formula | C28H43B2NO4S2 |
| Molecular Weight | 543.41 g/mol |
| Exact Mass | 543.28 |
| IUPAC Name | 7-octyl-4,10-bis(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-3,11-dithia-7-azatricyclo[6.3.0.02,6]undeca-1(8),2(6),4,9-tetraene |
| SMILES | CCCCCCCCn1c2cc(B3OC(C)(C)C(C)(C)O3)sc2c2sc(B3OC(C)(C)C(C)(C)O3)cc21 |
| InChI | InChI=1S/C28H43B2NO4S2/c1-10-11-12-13-14-15-16-31-19-17-21(29-32-25(2,3)26(4,5)33-29)36-23(19)24-20(31)18-22(37-24)30-34-27(6,7)28(8,9)35-30/h17-18H,10-16H2,1-9H3 |
| InChIKey | QVRGBKGRWMXJLX-UHFFFAOYSA-N |
| XLogP | 6.88 |
| TPSA | 41.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 543.41 |
| LogP ≤ 5 | 6.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|