C17H23NOS2 — CID 176800594
4-methoxy-7-octyl-3,11-dithia-7-azatricyclo[6.3.0.02,6]undeca-1(8),2(6),4,9-tetraene (PubChem CID 176800594) has the molecular formula C17H23NOS2 and a molecular weight of 321.51 g/mol. Its IUPAC name is 4-methoxy-7-octyl-3,11-dithia-7-azatricyclo[6.3.0.02,6]undeca-1(8),2(6),4,9-tetraene.
| Compound Name | 4-methoxy-7-octyl-3,11-dithia-7-azatricyclo[6.3.0.02,6]undeca-1(8),2(6),4,9-tetraene |
|---|---|
| PubChem CID | 176800594 |
| Molecular Formula | C17H23NOS2 |
| Molecular Weight | 321.51 g/mol |
| Exact Mass | 321.12 |
| IUPAC Name | 4-methoxy-7-octyl-3,11-dithia-7-azatricyclo[6.3.0.02,6]undeca-1(8),2(6),4,9-tetraene |
| SMILES | CCCCCCCCn1c2ccsc2c2sc(OC)cc21 |
| InChI | InChI=1S/C17H23NOS2/c1-3-4-5-6-7-8-10-18-13-9-11-20-16(13)17-14(18)12-15(19-2)21-17/h9,11-12H,3-8,10H2,1-2H3 |
| InChIKey | HKLJMUMXBVQNON-UHFFFAOYSA-N |
| XLogP | 6.29 |
| TPSA | 14.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.51 |
| LogP ≤ 5 | 6.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|