C42H62B2N2O6S2 — CID 132918185
2,5-dioctyl-1,4-bis[5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)thiophen-2-yl]pyrrolo[3,4-c]pyrrole-3,6-dione (PubChem CID 132918185) has the molecular formula C42H62B2N2O6S2 and a molecular weight of 776.72 g/mol. Its IUPAC name is 2,5-dioctyl-1,4-bis[5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)thiophen-2-yl]pyrrolo[3,4-c]pyrrole-3,6-dione.
| Compound Name | 2,5-dioctyl-1,4-bis[5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)thiophen-2-yl]pyrrolo[3,4-c]pyrrole-3,6-dione |
|---|---|
| PubChem CID | 132918185 |
| Molecular Formula | C42H62B2N2O6S2 |
| Molecular Weight | 776.72 g/mol |
| Exact Mass | 776.42 |
| IUPAC Name | 2,5-dioctyl-1,4-bis[5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)thiophen-2-yl]pyrrolo[3,4-c]pyrrole-3,6-dione |
| SMILES | CCCCCCCCN1C(=O)C2=C(c3ccc(B4OC(C)(C)C(C)(C)O4)s3)N(CCCCCCCC)C(=O)C2=C1c1ccc(B2OC(C)(C)C(C)(C)O2)s1 |
| InChI | InChI=1S/C42H62B2N2O6S2/c1-11-13-15-17-19-21-27-45-35(29-23-25-31(53-29)43-49-39(3,4)40(5,6)50-43)33-34(37(45)47)36(46(38(33)48)28-22-20-18-16-14-12-2)30-24-26-32(54-30)44-51-41(7,8)42(9,10)52-44/h23-26H,11-22,27-28H2,1-10H3 |
| InChIKey | PPAONHNMDMGLHN-UHFFFAOYSA-N |
| XLogP | 8.94 |
| TPSA | 77.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 776.72 |
| LogP ≤ 5 | 8.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'ene_five_het_C(85)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|