C34H46Br2N2O4 — CID 66974070
1,4-bis(5-bromofuran-2-yl)-2,5-didecylpyrrolo[3,4-c]pyrrole-3,6-dione (PubChem CID 66974070) has the molecular formula C34H46Br2N2O4 and a molecular weight of 706.56 g/mol. Its IUPAC name is 1,4-bis(5-bromofuran-2-yl)-2,5-didecylpyrrolo[3,4-c]pyrrole-3,6-dione.
| Compound Name | 1,4-bis(5-bromofuran-2-yl)-2,5-didecylpyrrolo[3,4-c]pyrrole-3,6-dione |
|---|---|
| PubChem CID | 66974070 |
| Molecular Formula | C34H46Br2N2O4 |
| Molecular Weight | 706.56 g/mol |
| Exact Mass | 704.18 |
| IUPAC Name | 1,4-bis(5-bromofuran-2-yl)-2,5-didecylpyrrolo[3,4-c]pyrrole-3,6-dione |
| SMILES | CCCCCCCCCCN1C(=O)C2=C(c3ccc(Br)o3)N(CCCCCCCCCC)C(=O)C2=C1c1ccc(Br)o1 |
| InChI | InChI=1S/C34H46Br2N2O4/c1-3-5-7-9-11-13-15-17-23-37-31(25-19-21-27(35)41-25)29-30(33(37)39)32(26-20-22-28(36)42-26)38(34(29)40)24-18-16-14-12-10-8-6-4-2/h19-22H,3-18,23-24H2,1-2H3 |
| InChIKey | XTKQSVQRXYQREJ-UHFFFAOYSA-N |
| XLogP | 10.49 |
| TPSA | 66.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 706.56 |
| LogP ≤ 5 | 10.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'ene_five_het_C(85)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|