C30H36Br2N2O2 — CID 149088316
1-(4-bromocyclohexa-1,3-dien-1-yl)-4-(4-bromophenyl)-2,5-dihexylpyrrolo[3,4-c]pyrrole-3,6-dione (PubChem CID 149088316) has the molecular formula C30H36Br2N2O2 and a molecular weight of 616.44 g/mol. Its IUPAC name is 1-(4-bromocyclohexa-1,3-dien-1-yl)-4-(4-bromophenyl)-2,5-dihexylpyrrolo[3,4-c]pyrrole-3,6-dione.
| Compound Name | 1-(4-bromocyclohexa-1,3-dien-1-yl)-4-(4-bromophenyl)-2,5-dihexylpyrrolo[3,4-c]pyrrole-3,6-dione |
|---|---|
| PubChem CID | 149088316 |
| Molecular Formula | C30H36Br2N2O2 |
| Molecular Weight | 616.44 g/mol |
| Exact Mass | 614.11 |
| IUPAC Name | 1-(4-bromocyclohexa-1,3-dien-1-yl)-4-(4-bromophenyl)-2,5-dihexylpyrrolo[3,4-c]pyrrole-3,6-dione |
| SMILES | CCCCCCN1C(=O)C2=C(c3ccc(Br)cc3)N(CCCCCC)C(=O)C2=C1C1=CC=C(Br)CC1 |
| InChI | InChI=1S/C30H36Br2N2O2/c1-3-5-7-9-19-33-27(21-11-15-23(31)16-12-21)25-26(29(33)35)28(22-13-17-24(32)18-14-22)34(30(25)36)20-10-8-6-4-2/h11-13,15-17H,3-10,14,18-20H2,1-2H3 |
| InChIKey | QRRPLOQLWDYUAQ-UHFFFAOYSA-N |
| XLogP | 8.26 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 616.44 |
| LogP ≤ 5 | 8.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'ene_five_het_C(85)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|