C37H47BrN2O4 — CID 102053266
4-(4-bromophenyl)-1-[4-(1,3-dioxolan-2-yl)phenyl]-2,5-dioctylpyrrolo[3,4-c]pyrrole-3,6-dione (PubChem CID 102053266) has the molecular formula C37H47BrN2O4 and a molecular weight of 663.70 g/mol. Its IUPAC name is 4-(4-bromophenyl)-1-[4-(1,3-dioxolan-2-yl)phenyl]-2,5-dioctylpyrrolo[3,4-c]pyrrole-3,6-dione.
| Compound Name | 4-(4-bromophenyl)-1-[4-(1,3-dioxolan-2-yl)phenyl]-2,5-dioctylpyrrolo[3,4-c]pyrrole-3,6-dione |
|---|---|
| PubChem CID | 102053266 |
| Molecular Formula | C37H47BrN2O4 |
| Molecular Weight | 663.70 g/mol |
| Exact Mass | 662.27 |
| IUPAC Name | 4-(4-bromophenyl)-1-[4-(1,3-dioxolan-2-yl)phenyl]-2,5-dioctylpyrrolo[3,4-c]pyrrole-3,6-dione |
| SMILES | CCCCCCCCN1C(=O)C2=C(c3ccc(C4OCCO4)cc3)N(CCCCCCCC)C(=O)C2=C1c1ccc(Br)cc1 |
| InChI | InChI=1S/C37H47BrN2O4/c1-3-5-7-9-11-13-23-39-33(27-15-17-29(18-16-27)37-43-25-26-44-37)31-32(36(39)42)34(28-19-21-30(38)22-20-28)40(35(31)41)24-14-12-10-8-6-4-2/h15-22,37H,3-14,23-26H2,1-2H3 |
| InChIKey | PBXMTCXDTYMYJA-UHFFFAOYSA-N |
| XLogP | 9.02 |
| TPSA | 59.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 663.70 |
| LogP ≤ 5 | 9.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'ene_five_het_C(85)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|