C20H28BO2S2+ — CID 58098289
2-[5-(5-hexylthiophen-2-yl)thiophen-2-yl]-4,5,5-trimethyl-4-methyl-1,3,2-dioxaborolane (PubChem CID 58098289) has the molecular formula C20H28BO2S2+ and a molecular weight of 375.39 g/mol. Its IUPAC name is 2-[5-(5-hexylthiophen-2-yl)thiophen-2-yl]-4,5,5-trimethyl-4-methyl-1,3,2-dioxaborolane.
| Compound Name | 2-[5-(5-hexylthiophen-2-yl)thiophen-2-yl]-4,5,5-trimethyl-4-methyl-1,3,2-dioxaborolane |
|---|---|
| PubChem CID | 58098289 |
| Molecular Formula | C20H28BO2S2+ |
| Molecular Weight | 375.39 g/mol |
| Exact Mass | 375.16 |
| IUPAC Name | 2-[5-(5-hexylthiophen-2-yl)thiophen-2-yl]-4,5,5-trimethyl-4-methyl-1,3,2-dioxaborolane |
| SMILES | [CH2+]C1(C)OB(c2ccc(-c3ccc(CCCCCC)s3)s2)OC1(C)C |
| InChI | InChI=1S/C20H28BO2S2/c1-6-7-8-9-10-15-11-12-16(24-15)17-13-14-18(25-17)21-22-19(2,3)20(4,5)23-21/h11-14H,2,6-10H2,1,3-5H3/q+1 |
| InChIKey | FLISXAHTAWBAME-UHFFFAOYSA-N |
| XLogP | 5.71 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.39 |
| LogP ≤ 5 | 5.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|