C24H37BO4S2 — CID 143861715
1-propoxy-1-[5-[5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)thiophen-2-yl]thiophen-2-yl]heptan-1-ol (PubChem CID 143861715) has the molecular formula C24H37BO4S2 and a molecular weight of 464.50 g/mol. Its IUPAC name is 1-propoxy-1-[5-[5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)thiophen-2-yl]thiophen-2-yl]heptan-1-ol.
| Compound Name | 1-propoxy-1-[5-[5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)thiophen-2-yl]thiophen-2-yl]heptan-1-ol |
|---|---|
| PubChem CID | 143861715 |
| Molecular Formula | C24H37BO4S2 |
| Molecular Weight | 464.50 g/mol |
| Exact Mass | 464.22 |
| IUPAC Name | 1-propoxy-1-[5-[5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)thiophen-2-yl]thiophen-2-yl]heptan-1-ol |
| SMILES | CCCCCCC(O)(OCCC)c1ccc(-c2ccc(B3OC(C)(C)C(C)(C)O3)s2)s1 |
| InChI | InChI=1S/C24H37BO4S2/c1-7-9-10-11-16-24(26,27-17-8-2)20-14-12-18(30-20)19-13-15-21(31-19)25-28-22(3,4)23(5,6)29-25/h12-15,26H,7-11,16-17H2,1-6H3 |
| InChIKey | ZANKDEFRPBITLA-UHFFFAOYSA-N |
| XLogP | 6.32 |
| TPSA | 47.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.50 |
| LogP ≤ 5 | 6.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|