C37H44N2O2 — CID 141416959
ethyl 2-(dibenzylamino)-2-[(dibenzylamino)methyl]hexanoate (PubChem CID 141416959) has the molecular formula C37H44N2O2 and a molecular weight of 548.77 g/mol. Its IUPAC name is ethyl 2-(dibenzylamino)-2-[(dibenzylamino)methyl]hexanoate.
| Compound Name | ethyl 2-(dibenzylamino)-2-[(dibenzylamino)methyl]hexanoate |
|---|---|
| PubChem CID | 141416959 |
| Molecular Formula | C37H44N2O2 |
| Molecular Weight | 548.77 g/mol |
| Exact Mass | 548.34 |
| IUPAC Name | ethyl 2-(dibenzylamino)-2-[(dibenzylamino)methyl]hexanoate |
| SMILES | CCCCC(CN(Cc1ccccc1)Cc1ccccc1)(C(=O)OCC)N(Cc1ccccc1)Cc1ccccc1 |
| InChI | InChI=1S/C37H44N2O2/c1-3-5-26-37(36(40)41-4-2,39(29-34-22-14-8-15-23-34)30-35-24-16-9-17-25-35)31-38(27-32-18-10-6-11-19-32)28-33-20-12-7-13-21-33/h6-25H,3-5,26-31H2,1-2H3 |
| InChIKey | YBSAGDLZHIGOMG-UHFFFAOYSA-N |
| XLogP | 7.88 |
| TPSA | 32.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 548.77 |
| LogP ≤ 5 | 7.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |