C9H14N2O — CID 141417035
1-amino-1-(3-aminophenyl)-3,3-dideuteriopropan-1-ol (PubChem CID 141417035) has the molecular formula C9H14N2O and a molecular weight of 168.24 g/mol. Its IUPAC name is 1-amino-1-(3-aminophenyl)-3,3-dideuteriopropan-1-ol.
| Compound Name | 1-amino-1-(3-aminophenyl)-3,3-dideuteriopropan-1-ol |
|---|---|
| PubChem CID | 141417035 |
| Molecular Formula | C9H14N2O |
| Molecular Weight | 168.24 g/mol |
| Exact Mass | 168.12 |
| IUPAC Name | 1-amino-1-(3-aminophenyl)-3,3-dideuteriopropan-1-ol |
| SMILES | [2H]C([2H])CC(N)(O)c1cccc(N)c1 |
| InChI | InChI=1S/C9H14N2O/c1-2-9(11,12)7-4-3-5-8(10)6-7/h3-6,12H,2,10-11H2,1H3/i1D2 |
| InChIKey | KSYYPHAYLVWTSO-DICFDUPASA-N |
| XLogP | 0.78 |
| TPSA | 72.27 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 168.24 |
| LogP ≤ 5 | 0.78 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|