C9H14OS — CID 14141735
(1R)-1-[(1S,3S,4R)-2-thiabicyclo[2.2.1]hept-5-en-3-yl]propan-1-ol (PubChem CID 14141735) has the molecular formula C9H14OS and a molecular weight of 170.28 g/mol. Its IUPAC name is (1R)-1-[(1S,3S,4R)-2-thiabicyclo[2.2.1]hept-5-en-3-yl]propan-1-ol.
| Compound Name | (1R)-1-[(1S,3S,4R)-2-thiabicyclo[2.2.1]hept-5-en-3-yl]propan-1-ol |
|---|---|
| PubChem CID | 14141735 |
| Molecular Formula | C9H14OS |
| Molecular Weight | 170.28 g/mol |
| Exact Mass | 170.08 |
| IUPAC Name | (1R)-1-[(1S,3S,4R)-2-thiabicyclo[2.2.1]hept-5-en-3-yl]propan-1-ol |
| SMILES | CC[C@@H](O)[C@H]1S[C@@H]2C=C[C@H]1C2 |
| InChI | InChI=1S/C9H14OS/c1-2-8(10)9-6-3-4-7(5-6)11-9/h3-4,6-10H,2,5H2,1H3/t6-,7+,8+,9-/m0/s1 |
| InChIKey | VDYVVRLRVGKURO-KDXUFGMBSA-N |
| XLogP | 1.82 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 170.28 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|