C8H12O2S — CID 134994041
(3R,3aS,7aS)-1-oxo-2,3,3a,6,7,7a-hexahydro-1-benzothiophen-3-ol (PubChem CID 134994041) has the molecular formula C8H12O2S and a molecular weight of 172.25 g/mol. Its IUPAC name is (3R,3aS,7aS)-1-oxo-2,3,3a,6,7,7a-hexahydro-1-benzothiophen-3-ol.
| Compound Name | (3R,3aS,7aS)-1-oxo-2,3,3a,6,7,7a-hexahydro-1-benzothiophen-3-ol |
|---|---|
| PubChem CID | 134994041 |
| Molecular Formula | C8H12O2S |
| Molecular Weight | 172.25 g/mol |
| Exact Mass | 172.06 |
| IUPAC Name | (3R,3aS,7aS)-1-oxo-2,3,3a,6,7,7a-hexahydro-1-benzothiophen-3-ol |
| SMILES | O=S1C[C@H](O)[C@@H]2C=CCC[C@@H]21 |
| InChI | InChI=1S/C8H12O2S/c9-7-5-11(10)8-4-2-1-3-6(7)8/h1,3,6-9H,2,4-5H2/t6-,7-,8-,11?/m0/s1 |
| InChIKey | KJNHRIKNXXZVPF-BONIJIIJSA-N |
| XLogP | 0.44 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 172.25 |
| LogP ≤ 5 | 0.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|