About 4-[2-(4-bromophenyl)-1,2,4-triazol-3-yl]benzenesulfonamide
4-[2-(4-bromophenyl)-1,2,4-triazol-3-yl]benzenesulfonamide (PubChem CID 141417875) has the molecular formula C14H11BrN4O2S
and a molecular weight of 379.24 g/mol. Its IUPAC name is 4-[2-(4-bromophenyl)-1,2,4-triazol-3-yl]benzenesulfonamide.
Molecular Properties
| Compound Name | 4-[2-(4-bromophenyl)-1,2,4-triazol-3-yl]benzenesulfonamide |
| PubChem CID | 141417875 |
| Molecular Formula | C14H11BrN4O2S |
| Molecular Weight | 379.24 g/mol |
| Exact Mass | 377.98 |
| IUPAC Name | 4-[2-(4-bromophenyl)-1,2,4-triazol-3-yl]benzenesulfonamide |
| SMILES | NS(=O)(=O)c1ccc(-c2ncnn2-c2ccc(Br)cc2)cc1 |
| InChI | InChI=1S/C14H11BrN4O2S/c15-11-3-5-12(6-4-11)19-14(17-9-18-19)10-1-7-13(8-2-10)22(16,20)21/h1-9H,(H2,16,20,21) |
| InChIKey | ZUIRHZZPYNONNM-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 90.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 379.24 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 4-[2-(4-bromophenyl)-1,2,4-triazol-3-yl]benzenesulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[2-(4-bromophenyl)-1,2,4-triazol-3-yl]benzenesulfonamide?
The IUPAC name of 4-[2-(4-bromophenyl)-1,2,4-triazol-3-yl]benzenesulfonamide (CID 141417875) is 4-[2-(4-bromophenyl)-1,2,4-triazol-3-yl]benzenesulfonamide.
What is the SMILES notation for 4-[2-(4-bromophenyl)-1,2,4-triazol-3-yl]benzenesulfonamide?
The canonical SMILES for 4-[2-(4-bromophenyl)-1,2,4-triazol-3-yl]benzenesulfonamide is NS(=O)(=O)c1ccc(-c2ncnn2-c2ccc(Br)cc2)cc1.
What is the InChIKey of 4-[2-(4-bromophenyl)-1,2,4-triazol-3-yl]benzenesulfonamide?
The InChIKey is ZUIRHZZPYNONNM-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H11BrN4O2S/c15-11-3-5-12(6-4-11)19-14(17-9-18-19)10-1-7-13(8-2-10)22(16,20)21/h1-9H,(H2,16,20,21).
What are the key properties of 4-[2-(4-bromophenyl)-1,2,4-triazol-3-yl]benzenesulfonamide?
4-[2-(4-bromophenyl)-1,2,4-triazol-3-yl]benzenesulfonamide has a molecular weight of 379.24 g/mol, XLogP of 2.34, 3 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[2-(4-bromophenyl)-1,2,4-triazol-3-yl]benzenesulfonamide is sourced from PubChem (CID 141417875), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).