C20H18N2OS — CID 141424138
9-[4-[(1S)-1-aminoethyl]phenyl]-6-methylthieno[2,3-c]quinolin-8-ol (PubChem CID 141424138) has the molecular formula C20H18N2OS and a molecular weight of 334.44 g/mol. Its IUPAC name is 9-[4-[(1S)-1-aminoethyl]phenyl]-6-methylthieno[2,3-c]quinolin-8-ol.
| Compound Name | 9-[4-[(1S)-1-aminoethyl]phenyl]-6-methylthieno[2,3-c]quinolin-8-ol |
|---|---|
| PubChem CID | 141424138 |
| Molecular Formula | C20H18N2OS |
| Molecular Weight | 334.44 g/mol |
| Exact Mass | 334.11 |
| IUPAC Name | 9-[4-[(1S)-1-aminoethyl]phenyl]-6-methylthieno[2,3-c]quinolin-8-ol |
| SMILES | Cc1cc(O)c(-c2ccc([C@H](C)N)cc2)c2c1ncc1sccc12 |
| InChI | InChI=1S/C20H18N2OS/c1-11-9-16(23)18(14-5-3-13(4-6-14)12(2)21)19-15-7-8-24-17(15)10-22-20(11)19/h3-10,12,23H,21H2,1-2H3/t12-/m0/s1 |
| InChIKey | WKPYSYRJUCKSFO-LBPRGKRZSA-N |
| XLogP | 5.15 |
| TPSA | 59.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.44 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |