C22H22N2OS — CID 141424217
9-[4-(1-aminobutan-2-yl)phenyl]-6-methylthieno[2,3-c]quinolin-8-ol (PubChem CID 141424217) has the molecular formula C22H22N2OS and a molecular weight of 362.50 g/mol. Its IUPAC name is 9-[4-(1-aminobutan-2-yl)phenyl]-6-methylthieno[2,3-c]quinolin-8-ol.
| Compound Name | 9-[4-(1-aminobutan-2-yl)phenyl]-6-methylthieno[2,3-c]quinolin-8-ol |
|---|---|
| PubChem CID | 141424217 |
| Molecular Formula | C22H22N2OS |
| Molecular Weight | 362.50 g/mol |
| Exact Mass | 362.15 |
| IUPAC Name | 9-[4-(1-aminobutan-2-yl)phenyl]-6-methylthieno[2,3-c]quinolin-8-ol |
| SMILES | CCC(CN)c1ccc(-c2c(O)cc(C)c3ncc4sccc4c23)cc1 |
| InChI | InChI=1S/C22H22N2OS/c1-3-14(11-23)15-4-6-16(7-5-15)20-18(25)10-13(2)22-21(20)17-8-9-26-19(17)12-24-22/h4-10,12,14,25H,3,11,23H2,1-2H3 |
| InChIKey | LIKFXDGLWWONGP-UHFFFAOYSA-N |
| XLogP | 5.58 |
| TPSA | 59.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.50 |
| LogP ≤ 5 | 5.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |