C36H42Si2 — CID 141424466
triethyl-(1-ethynyl-7-triethylsilylnaphtho[1,2-b]phenanthren-14-yl)silane (PubChem CID 141424466) has the molecular formula C36H42Si2 and a molecular weight of 530.90 g/mol. Its IUPAC name is triethyl-(1-ethynyl-7-triethylsilylnaphtho[1,2-b]phenanthren-14-yl)silane.
| Compound Name | triethyl-(1-ethynyl-7-triethylsilylnaphtho[1,2-b]phenanthren-14-yl)silane |
|---|---|
| PubChem CID | 141424466 |
| Molecular Formula | C36H42Si2 |
| Molecular Weight | 530.90 g/mol |
| Exact Mass | 530.28 |
| IUPAC Name | triethyl-(1-ethynyl-7-triethylsilylnaphtho[1,2-b]phenanthren-14-yl)silane |
| SMILES | C#Cc1cccc2ccc3c([Si](CC)(CC)CC)c4c(ccc5ccccc54)c([Si](CC)(CC)CC)c3c12 |
| InChI | InChI=1S/C36H42Si2/c1-8-26-19-17-20-28-23-25-31-34(32(26)28)36(38(12-5,13-6)14-7)30-24-22-27-18-15-16-21-29(27)33(30)35(31)37(9-2,10-3)11-4/h1,15-25H,9-14H2,2-7H3 |
| InChIKey | PVIIXZJVGVZBGR-UHFFFAOYSA-N |
| XLogP | 9.71 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.90 |
| LogP ≤ 5 | 9.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|