C28H44O2 — CID 141424710
1-[(1R,2R,3S,5R)-2-[(Z)-hept-2-enyl]-5-hydroxy-3-phenylcyclopentyl]decan-3-one (PubChem CID 141424710) has the molecular formula C28H44O2 and a molecular weight of 412.66 g/mol. Its IUPAC name is 1-[(1R,2R,3S,5R)-2-[(Z)-hept-2-enyl]-5-hydroxy-3-phenylcyclopentyl]decan-3-one.
| Compound Name | 1-[(1R,2R,3S,5R)-2-[(Z)-hept-2-enyl]-5-hydroxy-3-phenylcyclopentyl]decan-3-one |
|---|---|
| PubChem CID | 141424710 |
| Molecular Formula | C28H44O2 |
| Molecular Weight | 412.66 g/mol |
| Exact Mass | 412.33 |
| IUPAC Name | 1-[(1R,2R,3S,5R)-2-[(Z)-hept-2-enyl]-5-hydroxy-3-phenylcyclopentyl]decan-3-one |
| SMILES | CCCC/C=C\C[C@H]1[C@@H](CCC(=O)CCCCCCC)[C@H](O)C[C@@H]1c1ccccc1 |
| InChI | InChI=1S/C28H44O2/c1-3-5-7-9-14-18-24(29)20-21-26-25(19-15-10-8-6-4-2)27(22-28(26)30)23-16-12-11-13-17-23/h10-13,15-17,25-28,30H,3-9,14,18-22H2,1-2H3/b15-10-/t25-,26+,27+,28+/m0/s1 |
| InChIKey | YHXHOCSDPXPBIW-ALIYPTNQSA-N |
| XLogP | 7.61 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.66 |
| LogP ≤ 5 | 7.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|