C13H13F3O — CID 141425088
2,2,2-trifluoro-1-(2-pent-1-ynylphenyl)ethanol (PubChem CID 141425088) has the molecular formula C13H13F3O and a molecular weight of 242.24 g/mol. Its IUPAC name is 2,2,2-trifluoro-1-(2-pent-1-ynylphenyl)ethanol.
| Compound Name | 2,2,2-trifluoro-1-(2-pent-1-ynylphenyl)ethanol |
|---|---|
| PubChem CID | 141425088 |
| Molecular Formula | C13H13F3O |
| Molecular Weight | 242.24 g/mol |
| Exact Mass | 242.09 |
| IUPAC Name | 2,2,2-trifluoro-1-(2-pent-1-ynylphenyl)ethanol |
| SMILES | CCCC#Cc1ccccc1C(O)C(F)(F)F |
| InChI | InChI=1S/C13H13F3O/c1-2-3-4-7-10-8-5-6-9-11(10)12(17)13(14,15)16/h5-6,8-9,12,17H,2-3H2,1H3 |
| InChIKey | IFKBFLSWWUUNKM-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.24 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|